C24H46O3Si — CID 67659101
propan-2-yl 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate (PubChem CID 67659101) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is propan-2-yl 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate.
| Compound Name | propan-2-yl 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate |
|---|---|
| PubChem CID | 67659101 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | propan-2-yl 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentanoate |
| SMILES | CC(C)OC(=O)CCC(C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H46O3Si/c1-17(2)26-22(25)15-12-18(3)19-13-14-20-21(11-10-16-24(19,20)7)27-28(8,9)23(4,5)6/h17-21H,10-16H2,1-9H3/t18?,19-,20+,21+,24-/m1/s1 |
| InChIKey | NLRFCFYSPUMIDZ-DWGSDCDESA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|