About 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene
4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene (PubChem CID 67659277) has the molecular formula C13H16Br2F2
and a molecular weight of 370.08 g/mol. Its IUPAC name is 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene.
Molecular Properties
| Compound Name | 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene |
| PubChem CID | 67659277 |
| Molecular Formula | C13H16Br2F2 |
| Molecular Weight | 370.08 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene |
| SMILES | CC(C)=CCCBr.Fc1ccc(CBr)cc1F |
| InChI | InChI=1S/C7H5BrF2.C6H11Br/c8-4-5-1-2-6(9)7(10)3-5;1-6(2)4-3-5-7/h1-3H,4H2;4H,3,5H2,1-2H3 |
| InChIKey | RBMPLMWUAMEMOO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene?
The IUPAC name of 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene (CID 67659277) is 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene.
What is the SMILES notation for 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene?
The canonical SMILES for 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene is CC(C)=CCCBr.Fc1ccc(CBr)cc1F.
What is the InChIKey of 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene?
The InChIKey is RBMPLMWUAMEMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF2.C6H11Br/c8-4-5-1-2-6(9)7(10)3-5;1-6(2)4-3-5-7/h1-3H,4H2;4H,3,5H2,1-2H3.
What are the key properties of 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene?
4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene has a molecular weight of 370.08 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-1,2-difluorobenzene;5-bromo-2-methylpent-2-ene is sourced from PubChem (CID 67659277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).