C44H32N4 — CID 67659281
5,10,15,20-tetraphenyl-2,3,7,8-tetrahydroporphyrin (PubChem CID 67659281) has the molecular formula C44H32N4 and a molecular weight of 616.77 g/mol. Its IUPAC name is 5,10,15,20-tetraphenyl-2,3,7,8-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetraphenyl-2,3,7,8-tetrahydroporphyrin |
|---|---|
| PubChem CID | 67659281 |
| Molecular Formula | C44H32N4 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 5,10,15,20-tetraphenyl-2,3,7,8-tetrahydroporphyrin |
| SMILES | C1=C/C2=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/c6ccccc6)C1=N2)C=C5)CC4)CC3 |
| InChI | InChI=1S/C44H32N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-24H,25-28H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | JASDXJAZNJFSSD-LWQDQPMZSA-N |
| XLogP | 10.14 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |