C23H42O3Si — CID 67659554
ethyl (E,4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate (PubChem CID 67659554) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate |
|---|---|
| PubChem CID | 67659554 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | ethyl (E,4S)-4-[(1R,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H]1CC[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C23H42O3Si/c1-9-25-21(24)15-12-17(2)18-13-14-19-20(11-10-16-23(18,19)6)26-27(7,8)22(3,4)5/h12,15,17-20H,9-11,13-14,16H2,1-8H3/b15-12+/t17-,18+,19-,20+,23+/m0/s1 |
| InChIKey | LRNZWRKOUGMAED-SVQQMARUSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|