About 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate
1-hydroxyprop-2-enyl cyclopentene-1-carboxylate (PubChem CID 67659830) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate.
Molecular Properties
| Compound Name | 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate |
| PubChem CID | 67659830 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate |
| SMILES | C=CC(O)OC(=O)C1=CCCC1 |
| InChI | InChI=1S/C9H12O3/c1-2-8(10)12-9(11)7-5-3-4-6-7/h2,5,8,10H,1,3-4,6H2 |
| InChIKey | JKUPPNFYPFZQRR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate?
The IUPAC name of 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate (CID 67659830) is 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate.
What is the SMILES notation for 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate?
The canonical SMILES for 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate is C=CC(O)OC(=O)C1=CCCC1.
What is the InChIKey of 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate?
The InChIKey is JKUPPNFYPFZQRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-8(10)12-9(11)7-5-3-4-6-7/h2,5,8,10H,1,3-4,6H2.
What are the key properties of 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate?
1-hydroxyprop-2-enyl cyclopentene-1-carboxylate has a molecular weight of 168.19 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyprop-2-enyl cyclopentene-1-carboxylate is sourced from PubChem (CID 67659830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).