C28H25NO5S — CID 67659831
3-(benzenesulfonamido)-2-[2-(2-phenylmethoxyphenyl)ethyl]benzoic acid (PubChem CID 67659831) has the molecular formula C28H25NO5S and a molecular weight of 487.58 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-2-[2-(2-phenylmethoxyphenyl)ethyl]benzoic acid.
| Compound Name | 3-(benzenesulfonamido)-2-[2-(2-phenylmethoxyphenyl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 67659831 |
| Molecular Formula | C28H25NO5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 3-(benzenesulfonamido)-2-[2-(2-phenylmethoxyphenyl)ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2ccccc2)c1CCc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H25NO5S/c30-28(31)25-15-9-16-26(29-35(32,33)23-13-5-2-6-14-23)24(25)19-18-22-12-7-8-17-27(22)34-20-21-10-3-1-4-11-21/h1-17,29H,18-20H2,(H,30,31) |
| InChIKey | DSAZEDTXHLWSPD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |