About 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene]
8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] (PubChem CID 67660018) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene].
Molecular Properties
| Compound Name | 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] |
| PubChem CID | 67660018 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] |
| SMILES | COC(CC(C)C)c1cccc2c1OC1(C=C2)Cc2ccccc2N1 |
| InChI | InChI=1S/C22H25NO2/c1-15(2)13-20(24-3)18-9-6-8-16-11-12-22(25-21(16)18)14-17-7-4-5-10-19(17)23-22/h4-12,15,20,23H,13-14H2,1-3H3 |
| InChIKey | PNNQWIJUNMZJDX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene]?
The IUPAC name of 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] (CID 67660018) is 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene].
What is the SMILES notation for 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene]?
The canonical SMILES for 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] is COC(CC(C)C)c1cccc2c1OC1(C=C2)Cc2ccccc2N1.
What is the InChIKey of 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene]?
The InChIKey is PNNQWIJUNMZJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO2/c1-15(2)13-20(24-3)18-9-6-8-16-11-12-22(25-21(16)18)14-17-7-4-5-10-19(17)23-22/h4-12,15,20,23H,13-14H2,1-3H3.
What are the key properties of 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene]?
8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] has a molecular weight of 335.45 g/mol, XLogP of 5.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8'-(1-methoxy-3-methylbutyl)spiro[1,3-dihydroindole-2,2'-chromene] is sourced from PubChem (CID 67660018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).