About 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate
2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate (PubChem CID 67660122) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate |
| PubChem CID | 67660122 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC1CCCO1 |
| InChI | InChI=1S/C10H16O4/c1-8(2)10(11)14-7-6-13-9-4-3-5-12-9/h9H,1,3-7H2,2H3 |
| InChIKey | CHRMKNAJRPJMDG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate?
The IUPAC name of 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate (CID 67660122) is 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCOC1CCCO1.
What is the InChIKey of 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate?
The InChIKey is CHRMKNAJRPJMDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-8(2)10(11)14-7-6-13-9-4-3-5-12-9/h9H,1,3-7H2,2H3.
What are the key properties of 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate?
2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate has a molecular weight of 200.23 g/mol, XLogP of 1.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yloxy)ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 67660122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).