C22H22Cl3FN2OS — CID 67660299
N-[(4-fluorophenyl)methyl]-N-(1-methoxybutan-2-yl)-5-methyl-4-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 67660299) has the molecular formula C22H22Cl3FN2OS and a molecular weight of 487.86 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(1-methoxybutan-2-yl)-5-methyl-4-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(1-methoxybutan-2-yl)-5-methyl-4-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 67660299 |
| Molecular Formula | C22H22Cl3FN2OS |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(1-methoxybutan-2-yl)-5-methyl-4-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | CCC(COC)N(Cc1ccc(F)cc1)c1nc(-c2cc(Cl)c(Cl)cc2Cl)c(C)s1 |
| InChI | InChI=1S/C22H22Cl3FN2OS/c1-4-16(12-29-3)28(11-14-5-7-15(26)8-6-14)22-27-21(13(2)30-22)17-9-19(24)20(25)10-18(17)23/h5-10,16H,4,11-12H2,1-3H3 |
| InChIKey | YOFWSFIUCJVFPK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|