C26H39NO5 — CID 67661143
benzyl (4S,5S)-4-(cyclohexylmethyl)-5-[[(4R)-5,5-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 67661143) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is benzyl (4S,5S)-4-(cyclohexylmethyl)-5-[[(4R)-5,5-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S,5S)-4-(cyclohexylmethyl)-5-[[(4R)-5,5-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 67661143 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | benzyl (4S,5S)-4-(cyclohexylmethyl)-5-[[(4R)-5,5-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)OCO[C@@H]1C[C@@H]1OC(C)(C)N(C(=O)OCc2ccccc2)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C26H39NO5/c1-25(2)23(30-18-31-25)16-22-21(15-19-11-7-5-8-12-19)27(26(3,4)32-22)24(28)29-17-20-13-9-6-10-14-20/h6,9-10,13-14,19,21-23H,5,7-8,11-12,15-18H2,1-4H3/t21-,22-,23+/m0/s1 |
| InChIKey | UHXVWUFPUVOBSP-RJGXRXQPSA-N |
| XLogP | 5.64 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |