C26H40NO5+ — CID 67661201
benzyl (4S,5S)-4-(cyclohexylmethyl)-5-(5,5-dimethyl-1,3-dioxolan-4-yl)-2,2,3-trimethyl-1,3-oxazolidin-3-ium-3-carboxylate (PubChem CID 67661201) has the molecular formula C26H40NO5+ and a molecular weight of 446.61 g/mol. Its IUPAC name is benzyl (4S,5S)-4-(cyclohexylmethyl)-5-(5,5-dimethyl-1,3-dioxolan-4-yl)-2,2,3-trimethyl-1,3-oxazolidin-3-ium-3-carboxylate.
| Compound Name | benzyl (4S,5S)-4-(cyclohexylmethyl)-5-(5,5-dimethyl-1,3-dioxolan-4-yl)-2,2,3-trimethyl-1,3-oxazolidin-3-ium-3-carboxylate |
|---|---|
| PubChem CID | 67661201 |
| Molecular Formula | C26H40NO5+ |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | benzyl (4S,5S)-4-(cyclohexylmethyl)-5-(5,5-dimethyl-1,3-dioxolan-4-yl)-2,2,3-trimethyl-1,3-oxazolidin-3-ium-3-carboxylate |
| SMILES | CC1(C)OCOC1[C@H]1OC(C)(C)[N+](C)(C(=O)OCc2ccccc2)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C26H40NO5/c1-25(2)23(30-18-31-25)22-21(16-19-12-8-6-9-13-19)27(5,26(3,4)32-22)24(28)29-17-20-14-10-7-11-15-20/h7,10-11,14-15,19,21-23H,6,8-9,12-13,16-18H2,1-5H3/q+1/t21-,22-,23?,27?/m0/s1 |
| InChIKey | WBANELFEGFCTKC-SRRHAGQNSA-N |
| XLogP | 5.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|