C17H13N3O2S2 — CID 67661749
4-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]indol-4-yl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 67661749) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]indol-4-yl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]indol-4-yl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67661749 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]indol-4-yl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1nc(Cn2ccc3c(C=C4NC(=O)SC4=O)cccc32)cs1 |
| InChI | InChI=1S/C17H13N3O2S2/c1-10-18-12(9-23-10)8-20-6-5-13-11(3-2-4-15(13)20)7-14-16(21)24-17(22)19-14/h2-7,9H,8H2,1H3,(H,19,22) |
| InChIKey | MWMYWYYNAOTNSX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|