C31H34ClN2O7+ — CID 67661768
(3S)-2-acetyl-3-[[(1S,5R)-7-chloro-1-(2,2-dimethylpropyl)-5-naphthalen-1-yl-2-oxo-5H-4,1-benzoxazepin-1-ium-1-yl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 67661768) has the molecular formula C31H34ClN2O7+ and a molecular weight of 582.07 g/mol. Its IUPAC name is (3S)-2-acetyl-3-[[(1S,5R)-7-chloro-1-(2,2-dimethylpropyl)-5-naphthalen-1-yl-2-oxo-5H-4,1-benzoxazepin-1-ium-1-yl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (3S)-2-acetyl-3-[[(1S,5R)-7-chloro-1-(2,2-dimethylpropyl)-5-naphthalen-1-yl-2-oxo-5H-4,1-benzoxazepin-1-ium-1-yl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67661768 |
| Molecular Formula | C31H34ClN2O7+ |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | (3S)-2-acetyl-3-[[(1S,5R)-7-chloro-1-(2,2-dimethylpropyl)-5-naphthalen-1-yl-2-oxo-5H-4,1-benzoxazepin-1-ium-1-yl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)[C@@H](N[N@+]1(CC(C)(C)C)C(=O)CO[C@H](c2cccc3ccccc23)c2cc(Cl)ccc21)C(C(C)=O)C(=O)O |
| InChI | InChI=1S/C31H33ClN2O7/c1-18(35)26(29(37)38)27(30(39)40-5)33-34(17-31(2,3)4)24-14-13-20(32)15-23(24)28(41-16-25(34)36)22-12-8-10-19-9-6-7-11-21(19)22/h6-15,26-28,33H,16-17H2,1-5H3/p+1/t26?,27-,28+,34-/m0/s1 |
| InChIKey | UZMBTCKNEBQIJL-WRKUHSBJSA-O |
| XLogP | 4.83 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|