C18H31NO4 — CID 67661785
(4S,5S)-4-(cyclohexylmethyl)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-oxazolidin-2-one (PubChem CID 67661785) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is (4S,5S)-4-(cyclohexylmethyl)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-4-(cyclohexylmethyl)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67661785 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (4S,5S)-4-(cyclohexylmethyl)-3-methyl-5-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)O[C@H](C2OC(C)(C)OC2(C)C)[C@@H]1CC1CCCCC1 |
| InChI | InChI=1S/C18H31NO4/c1-17(2)15(22-18(3,4)23-17)14-13(19(5)16(20)21-14)11-12-9-7-6-8-10-12/h12-15H,6-11H2,1-5H3/t13-,14-,15?/m0/s1 |
| InChIKey | HNNUVSMJYWFUDI-ZYOSVBKOSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |