C10H14N2S — CID 67661922
2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl)-1,3-thiazole (PubChem CID 67661922) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl)-1,3-thiazole.
| Compound Name | 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 67661922 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl)-1,3-thiazole |
| SMILES | c1csc(C2CCC3CCCN32)n1 |
| InChI | InChI=1S/C10H14N2S/c1-2-8-3-4-9(12(8)6-1)10-11-5-7-13-10/h5,7-9H,1-4,6H2 |
| InChIKey | JUJHMVUMQOROIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |