C12H13Cl3N4O — CID 67661932
5,7-dichloro-N-(N,N'-dimethylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride (PubChem CID 67661932) has the molecular formula C12H13Cl3N4O and a molecular weight of 335.62 g/mol. Its IUPAC name is 5,7-dichloro-N-(N,N'-dimethylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | 5,7-dichloro-N-(N,N'-dimethylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67661932 |
| Molecular Formula | C12H13Cl3N4O |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5,7-dichloro-N-(N,N'-dimethylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride |
| SMILES | C/N=C(\NC)NC(=O)c1cc2cc(Cl)cc(Cl)c2[nH]1.Cl |
| InChI | InChI=1S/C12H12Cl2N4O.ClH/c1-15-12(16-2)18-11(19)9-4-6-3-7(13)5-8(14)10(6)17-9;/h3-5,17H,1-2H3,(H2,15,16,18,19);1H |
| InChIKey | SOGNGQOMOVFXGK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|