About methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate
methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate (PubChem CID 67661945) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate |
| PubChem CID | 67661945 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2n[nH]c(CCCCNC3=NCCN3)c12 |
| InChI | InChI=1S/C16H21N5O2/c1-23-15(22)11-5-4-7-13-14(11)12(20-21-13)6-2-3-8-17-16-18-9-10-19-16/h4-5,7H,2-3,6,8-10H2,1H3,(H,20,21)(H2,17,18,19) |
| InChIKey | IEYNTDPPYZKAHW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate?
The IUPAC name of methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate (CID 67661945) is methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate.
What is the SMILES notation for methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate?
The canonical SMILES for methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate is COC(=O)c1cccc2n[nH]c(CCCCNC3=NCCN3)c12.
What is the InChIKey of methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate?
The InChIKey is IEYNTDPPYZKAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O2/c1-23-15(22)11-5-4-7-13-14(11)12(20-21-13)6-2-3-8-17-16-18-9-10-19-16/h4-5,7H,2-3,6,8-10H2,1H3,(H,20,21)(H2,17,18,19).
What are the key properties of methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate?
methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate has a molecular weight of 315.38 g/mol, XLogP of 1.22, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butyl]-2H-indazole-4-carboxylate is sourced from PubChem (CID 67661945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).