C30H31N6O2+ — CID 67663047
ethyl 5-benzyl-1-methyl-1-propyl-3-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-carboxylate (PubChem CID 67663047) has the molecular formula C30H31N6O2+ and a molecular weight of 507.62 g/mol. Its IUPAC name is ethyl 5-benzyl-1-methyl-1-propyl-3-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-carboxylate.
| Compound Name | ethyl 5-benzyl-1-methyl-1-propyl-3-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 67663047 |
| Molecular Formula | C30H31N6O2+ |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | ethyl 5-benzyl-1-methyl-1-propyl-3-[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]pyrazol-1-ium-4-carboxylate |
| SMILES | CCC[N+]1(C)N=C(c2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C(C(=O)OCC)=C1Cc1ccccc1 |
| InChI | InChI=1S/C30H31N6O2/c1-4-19-36(3)26(20-21-11-7-6-8-12-21)27(30(37)38-5-2)28(33-36)23-17-15-22(16-18-23)24-13-9-10-14-25(24)29-31-34-35-32-29/h6-18H,4-5,19-20H2,1-3H3,(H,31,32,34,35)/q+1 |
| InChIKey | VENFSVKZZQPDDR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|