C16H14ClN3O4S2 — CID 67663311
2-[5-(4-chlorophenyl)-4-methylsulfonylpyrazol-1-yl]benzenesulfonamide (PubChem CID 67663311) has the molecular formula C16H14ClN3O4S2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-4-methylsulfonylpyrazol-1-yl]benzenesulfonamide.
| Compound Name | 2-[5-(4-chlorophenyl)-4-methylsulfonylpyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67663311 |
| Molecular Formula | C16H14ClN3O4S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-4-methylsulfonylpyrazol-1-yl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cnn(-c2ccccc2S(N)(=O)=O)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O4S2/c1-25(21,22)15-10-19-20(16(15)11-6-8-12(17)9-7-11)13-4-2-3-5-14(13)26(18,23)24/h2-10H,1H3,(H2,18,23,24) |
| InChIKey | DUNIWIBKADUOPL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |