About 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide
3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide (PubChem CID 67663827) has the molecular formula C8H11N3O2
and a molecular weight of 181.20 g/mol. Its IUPAC name is 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide.
Molecular Properties
| Compound Name | 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide |
| PubChem CID | 67663827 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide |
| SMILES | NC(=O)CC(O)C1=CN=CNC=C1 |
| InChI | InChI=1S/C8H11N3O2/c9-8(13)3-7(12)6-1-2-10-5-11-4-6/h1-2,4-5,7,12H,3H2,(H2,9,13)(H,10,11) |
| InChIKey | NYVGFEMQBAJJBV-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide?
The IUPAC name of 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide (CID 67663827) is 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide.
What is the SMILES notation for 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide?
The canonical SMILES for 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide is NC(=O)CC(O)C1=CN=CNC=C1.
What is the InChIKey of 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide?
The InChIKey is NYVGFEMQBAJJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c9-8(13)3-7(12)6-1-2-10-5-11-4-6/h1-2,4-5,7,12H,3H2,(H2,9,13)(H,10,11).
What are the key properties of 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide?
3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide has a molecular weight of 181.20 g/mol, XLogP of -0.75, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-1,3-diazepin-5-yl)-3-hydroxypropanamide is sourced from PubChem (CID 67663827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).