C11H18N2O2 — CID 67663995
ethyl N-[(3aR,4R,7aR)-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl]carbamate (PubChem CID 67663995) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is ethyl N-[(3aR,4R,7aR)-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl]carbamate.
| Compound Name | ethyl N-[(3aR,4R,7aR)-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 67663995 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethyl N-[(3aR,4R,7aR)-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CC=C[C@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C11H18N2O2/c1-2-15-11(14)13-10-5-3-4-8-6-12-7-9(8)10/h3-4,8-10,12H,2,5-7H2,1H3,(H,13,14)/t8-,9-,10+/m0/s1 |
| InChIKey | SFFNNTIOVURBBE-LPEHRKFASA-N |
| XLogP | 0.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|