About N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide
N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide (PubChem CID 676642) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide |
| PubChem CID | 676642 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide |
| SMILES | CC(=O)Nc1c(C)nn(C(C)=O)c1C |
| InChI | InChI=1S/C9H13N3O2/c1-5-9(10-7(3)13)6(2)12(11-5)8(4)14/h1-4H3,(H,10,13) |
| InChIKey | QFRRIQDMXQWFKM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide?
The IUPAC name of N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide (CID 676642) is N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide.
What is the SMILES notation for N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide?
The canonical SMILES for N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide is CC(=O)Nc1c(C)nn(C(C)=O)c1C.
What is the InChIKey of N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide?
The InChIKey is QFRRIQDMXQWFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-5-9(10-7(3)13)6(2)12(11-5)8(4)14/h1-4H3,(H,10,13).
What are the key properties of N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide?
N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide has a molecular weight of 195.22 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-acetyl-3,5-dimethylpyrazol-4-yl)acetamide is sourced from PubChem (CID 676642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).