C28H37N5O4S — CID 67664641
N-(4-carbamimidoylphenyl)-1-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 67664641) has the molecular formula C28H37N5O4S and a molecular weight of 539.70 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-1-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-(4-carbamimidoylphenyl)-1-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 67664641 |
| Molecular Formula | C28H37N5O4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-1-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)C(=O)C2CC3CCCCC3N2C(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C28H37N5O4S/c1-3-38(36,37)31-23(17-19-9-5-4-6-10-19)27(34)33-24-12-8-7-11-21(24)18-25(33)28(35)32(2)22-15-13-20(14-16-22)26(29)30/h4-6,9-10,13-16,21,23-25,31H,3,7-8,11-12,17-18H2,1-2H3,(H3,29,30)/t21?,23-,24?,25?/m1/s1 |
| InChIKey | XGCRFLJLMRORFV-FCGQFZHESA-N |
| XLogP | 2.64 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|