About [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea
[1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea (PubChem CID 67665374) has the molecular formula C23H30FN3O
and a molecular weight of 383.51 g/mol. Its IUPAC name is [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea.
Molecular Properties
| Compound Name | [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea |
| PubChem CID | 67665374 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea |
| SMILES | CCCN(CCC)CC1(NC(N)=O)CC(c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C23H30FN3O/c1-3-13-27(14-4-2)16-23(26-22(25)28)15-20(17-9-11-18(24)12-10-17)19-7-5-6-8-21(19)23/h5-12,20H,3-4,13-16H2,1-2H3,(H3,25,26,28) |
| InChIKey | FNJJPVREBROLAY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea?
The IUPAC name of [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea (CID 67665374) is [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea.
What is the SMILES notation for [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea?
The canonical SMILES for [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea is CCCN(CCC)CC1(NC(N)=O)CC(c2ccc(F)cc2)c2ccccc21.
What is the InChIKey of [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea?
The InChIKey is FNJJPVREBROLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30FN3O/c1-3-13-27(14-4-2)16-23(26-22(25)28)15-20(17-9-11-18(24)12-10-17)19-7-5-6-8-21(19)23/h5-12,20H,3-4,13-16H2,1-2H3,(H3,25,26,28).
What are the key properties of [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea?
[1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea has a molecular weight of 383.51 g/mol, XLogP of 4.35, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(dipropylamino)methyl]-3-(4-fluorophenyl)-2,3-dihydroinden-1-yl]urea is sourced from PubChem (CID 67665374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).