C24H27ClN4O6 — CID 67666186
3-[(2,4-diaminopyrimidin-5-yl)methyl]-3,4,5,6-tetramethoxy-2-(2-phenylethynyl)cyclohexa-1,5-diene-1-carboxylic acid;hydrochloride (PubChem CID 67666186) has the molecular formula C24H27ClN4O6 and a molecular weight of 502.96 g/mol. Its IUPAC name is 3-[(2,4-diaminopyrimidin-5-yl)methyl]-3,4,5,6-tetramethoxy-2-(2-phenylethynyl)cyclohexa-1,5-diene-1-carboxylic acid;hydrochloride.
| Compound Name | 3-[(2,4-diaminopyrimidin-5-yl)methyl]-3,4,5,6-tetramethoxy-2-(2-phenylethynyl)cyclohexa-1,5-diene-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67666186 |
| Molecular Formula | C24H27ClN4O6 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 3-[(2,4-diaminopyrimidin-5-yl)methyl]-3,4,5,6-tetramethoxy-2-(2-phenylethynyl)cyclohexa-1,5-diene-1-carboxylic acid;hydrochloride |
| SMILES | COC1=C(OC)C(OC)C(Cc2cnc(N)nc2N)(OC)C(C#Cc2ccccc2)=C1C(=O)O.Cl |
| InChI | InChI=1S/C24H26N4O6.ClH/c1-31-18-17(22(29)30)16(11-10-14-8-6-5-7-9-14)24(34-4,20(33-3)19(18)32-2)12-15-13-27-23(26)28-21(15)25;/h5-9,13,20H,12H2,1-4H3,(H,29,30)(H4,25,26,27,28);1H |
| InChIKey | MAACSFKRIDWZSO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 152.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|