About (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide
(2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide (PubChem CID 67666210) has the molecular formula C20H21N3O3
and a molecular weight of 351.41 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide |
| PubChem CID | 67666210 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide |
| SMILES | C[C@@H](N)C(=O)NCCCNc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H21N3O3/c1-12(21)20(26)23-10-4-9-22-13-7-8-16-17(11-13)19(25)15-6-3-2-5-14(15)18(16)24/h2-3,5-8,11-12,22H,4,9-10,21H2,1H3,(H,23,26)/t12-/m1/s1 |
| InChIKey | BIFQYPAXBHWYAR-GFCCVEGCSA-N |
| XLogP | 1.73 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide?
The IUPAC name of (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide (CID 67666210) is (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide.
What is the SMILES notation for (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide?
The canonical SMILES for (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide is C[C@@H](N)C(=O)NCCCNc1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide?
The InChIKey is BIFQYPAXBHWYAR-GFCCVEGCSA-N. The full InChI is InChI=1S/C20H21N3O3/c1-12(21)20(26)23-10-4-9-22-13-7-8-16-17(11-13)19(25)15-6-3-2-5-14(15)18(16)24/h2-3,5-8,11-12,22H,4,9-10,21H2,1H3,(H,23,26)/t12-/m1/s1.
What are the key properties of (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide?
(2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide has a molecular weight of 351.41 g/mol, XLogP of 1.73, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-[3-[(9,10-dioxoanthracen-2-yl)amino]propyl]propanamide is sourced from PubChem (CID 67666210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).