About 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide
2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 676665) has the molecular formula C10H5ClF2N2OS
and a molecular weight of 274.68 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 676665 |
| Molecular Formula | C10H5ClF2N2OS |
| Molecular Weight | 274.68 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C10H5ClF2N2OS/c11-6-4-8(13)7(12)3-5(6)9(16)15-10-14-1-2-17-10/h1-4H,(H,14,15,16) |
| InChIKey | ZCEYDGPBMQFAEZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide (CID 676665) is 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide is O=C(Nc1nccs1)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is ZCEYDGPBMQFAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClF2N2OS/c11-6-4-8(13)7(12)3-5(6)9(16)15-10-14-1-2-17-10/h1-4H,(H,14,15,16).
What are the key properties of 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide?
2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 274.68 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-difluoro-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 676665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).