About 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile
3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile (PubChem CID 67666727) has the molecular formula C8H9ClN4S2
and a molecular weight of 260.77 g/mol. Its IUPAC name is 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile.
Molecular Properties
| Compound Name | 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile |
| PubChem CID | 67666727 |
| Molecular Formula | C8H9ClN4S2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile |
| SMILES | CCCCSc1nsnc1Cl.N#CC#N |
| InChI | InChI=1S/C6H9ClN2S2.C2N2/c1-2-3-4-10-6-5(7)8-11-9-6;3-1-2-4/h2-4H2,1H3; |
| InChIKey | ZDYTZLOXVVFQNV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile?
The IUPAC name of 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile (CID 67666727) is 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile.
What is the SMILES notation for 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile?
The canonical SMILES for 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile is CCCCSc1nsnc1Cl.N#CC#N.
What is the InChIKey of 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile?
The InChIKey is ZDYTZLOXVVFQNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2S2.C2N2/c1-2-3-4-10-6-5(7)8-11-9-6;3-1-2-4/h2-4H2,1H3;.
What are the key properties of 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile?
3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile has a molecular weight of 260.77 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole;oxalonitrile is sourced from PubChem (CID 67666727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).