C21H25N5O3 — CID 67666979
(2R)-2-amino-N-[2-[[4-(2-aminoethylamino)-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide (PubChem CID 67666979) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-[[4-(2-aminoethylamino)-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide.
| Compound Name | (2R)-2-amino-N-[2-[[4-(2-aminoethylamino)-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 67666979 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (2R)-2-amino-N-[2-[[4-(2-aminoethylamino)-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide |
| SMILES | C[C@@H](N)C(=O)NCCNc1ccc(NCCN)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H25N5O3/c1-12(23)21(29)26-11-10-25-16-7-6-15(24-9-8-22)17-18(16)20(28)14-5-3-2-4-13(14)19(17)27/h2-7,12,24-25H,8-11,22-23H2,1H3,(H,26,29)/t12-/m1/s1 |
| InChIKey | BNMUUHNUPUHVSI-GFCCVEGCSA-N |
| XLogP | 0.71 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|