C30H27N3O3 — CID 67667300
4-[[(10aS)-5-ethyl-1,3-dioxo-2-phenyl-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-8-yl]oxymethyl]benzonitrile (PubChem CID 67667300) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[[(10aS)-5-ethyl-1,3-dioxo-2-phenyl-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-8-yl]oxymethyl]benzonitrile.
| Compound Name | 4-[[(10aS)-5-ethyl-1,3-dioxo-2-phenyl-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-8-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 67667300 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-[[(10aS)-5-ethyl-1,3-dioxo-2-phenyl-9-prop-2-enyl-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-8-yl]oxymethyl]benzonitrile |
| SMILES | C=CCc1c(OCc2ccc(C#N)cc2)ccc2c1C[C@H]1C(=O)N(c3ccccc3)C(=O)N1C2CC |
| InChI | InChI=1S/C30H27N3O3/c1-3-8-24-25-17-27-29(34)32(22-9-6-5-7-10-22)30(35)33(27)26(4-2)23(25)15-16-28(24)36-19-21-13-11-20(18-31)12-14-21/h3,5-7,9-16,26-27H,1,4,8,17,19H2,2H3/t26?,27-/m0/s1 |
| InChIKey | GRVXZQJJUJZELM-GEVKEYJPSA-N |
| XLogP | 5.71 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|