C28H37N5OS — CID 67668724
N-amino-N-[4-(diethylamino)cyclohexyl]-N'-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]methanimidamide (PubChem CID 67668724) has the molecular formula C28H37N5OS and a molecular weight of 491.71 g/mol. Its IUPAC name is N-amino-N-[4-(diethylamino)cyclohexyl]-N'-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]methanimidamide.
| Compound Name | N-amino-N-[4-(diethylamino)cyclohexyl]-N'-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]methanimidamide |
|---|---|
| PubChem CID | 67668724 |
| Molecular Formula | C28H37N5OS |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | N-amino-N-[4-(diethylamino)cyclohexyl]-N'-[4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl]methanimidamide |
| SMILES | CCN(CC)C1CCC(N(N)C=Nc2nc(-c3ccccc3Oc3ccc(C)cc3C)cs2)CC1 |
| InChI | InChI=1S/C28H37N5OS/c1-5-32(6-2)22-12-14-23(15-13-22)33(29)19-30-28-31-25(18-35-28)24-9-7-8-10-27(24)34-26-16-11-20(3)17-21(26)4/h7-11,16-19,22-23H,5-6,12-15,29H2,1-4H3 |
| InChIKey | ZFJNBYOORMNKSO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|