About tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate
tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate (PubChem CID 67668950) has the molecular formula C21H34N2O5
and a molecular weight of 394.51 g/mol. Its IUPAC name is tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate |
| PubChem CID | 67668950 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate |
| SMILES | COc1cc(C)cc(OC)c1CN(C(=O)NCCC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O5/c1-14(2)9-10-22-19(24)23(20(25)28-21(4,5)6)13-16-17(26-7)11-15(3)12-18(16)27-8/h11-12,14H,9-10,13H2,1-8H3,(H,22,24) |
| InChIKey | YJVDVDRUZDKEND-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate?
The IUPAC name of tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate (CID 67668950) is tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate.
What is the SMILES notation for tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate?
The canonical SMILES for tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate is COc1cc(C)cc(OC)c1CN(C(=O)NCCC(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate?
The InChIKey is YJVDVDRUZDKEND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O5/c1-14(2)9-10-22-19(24)23(20(25)28-21(4,5)6)13-16-17(26-7)11-15(3)12-18(16)27-8/h11-12,14H,9-10,13H2,1-8H3,(H,22,24).
What are the key properties of tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate?
tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate has a molecular weight of 394.51 g/mol, XLogP of 4.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2,6-dimethoxy-4-methylphenyl)methyl]-N-(3-methylbutylcarbamoyl)carbamate is sourced from PubChem (CID 67668950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).