C30H38F3N2O+ — CID 67669006
3-[(2R,4aR,6R)-2-(cyclopropylmethyl)-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenol (PubChem CID 67669006) has the molecular formula C30H38F3N2O+ and a molecular weight of 499.64 g/mol. Its IUPAC name is 3-[(2R,4aR,6R)-2-(cyclopropylmethyl)-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenol.
| Compound Name | 3-[(2R,4aR,6R)-2-(cyclopropylmethyl)-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenol |
|---|---|
| PubChem CID | 67669006 |
| Molecular Formula | C30H38F3N2O+ |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 3-[(2R,4aR,6R)-2-(cyclopropylmethyl)-2-methyl-6-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenol |
| SMILES | C[N@+]1(CC2CC2)CC[C@@]2(c3cccc(O)c3)C[C@H](NCC=Cc3cccc(C(F)(F)F)c3)CCC2C1 |
| InChI | InChI=1S/C30H37F3N2O/c1-35(20-23-10-11-23)16-14-29(24-7-3-9-28(36)18-24)19-27(13-12-26(29)21-35)34-15-4-6-22-5-2-8-25(17-22)30(31,32)33/h2-9,17-18,23,26-27,34H,10-16,19-21H2,1H3/p+1/t26?,27-,29+,35-/m1/s1 |
| InChIKey | MEFAQHCYHZNLPG-UQAXGDRTSA-O |
| XLogP | 6.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|