C47H47N5O3 — CID 67669396
N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]benzamide;N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1-benzofuran-5-yl]benzamide (PubChem CID 67669396) has the molecular formula C47H47N5O3 and a molecular weight of 729.93 g/mol. Its IUPAC name is N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]benzamide;N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1-benzofuran-5-yl]benzamide.
| Compound Name | N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]benzamide;N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1-benzofuran-5-yl]benzamide |
|---|---|
| PubChem CID | 67669396 |
| Molecular Formula | C47H47N5O3 |
| Molecular Weight | 729.93 g/mol |
| Exact Mass | 729.37 |
| IUPAC Name | N-[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-1H-indol-5-yl]benzamide;N-[3-(4,6,7,8,9,9a-hexahydro-1H-quinolizin-2-yl)-1-benzofuran-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2[nH]cc(C3=CCN4CCCC4C3)c2c1)c1ccccc1.O=C(Nc1ccc2occ(C3=CCN4CCCCC4C3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2.C23H23N3O/c27-24(17-6-2-1-3-7-17)25-19-9-10-23-21(15-19)22(16-28-23)18-11-13-26-12-5-4-8-20(26)14-18;27-23(16-5-2-1-3-6-16)25-18-8-9-22-20(14-18)21(15-24-22)17-10-12-26-11-4-7-19(26)13-17/h1-3,6-7,9-11,15-16,20H,4-5,8,12-14H2,(H,25,27);1-3,5-6,8-10,14-15,19,24H,4,7,11-13H2,(H,25,27) |
| InChIKey | ZGXMAGBQMYMUMA-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.93 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |