About 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole
4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole (PubChem CID 67669491) has the molecular formula C20H14FNO2S3
and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole |
| PubChem CID | 67669491 |
| Molecular Formula | C20H14FNO2S3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2sc(-c3cccs3)nc2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H14FNO2S3/c1-27(23,24)14-10-8-13(9-11-14)19-18(15-5-2-3-6-16(15)21)22-20(26-19)17-7-4-12-25-17/h2-12H,1H3 |
| InChIKey | JRVYCDIGUXJATL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole?
The IUPAC name of 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole (CID 67669491) is 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole.
What is the SMILES notation for 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole?
The canonical SMILES for 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole is CS(=O)(=O)c1ccc(-c2sc(-c3cccs3)nc2-c2ccccc2F)cc1.
What is the InChIKey of 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole?
The InChIKey is JRVYCDIGUXJATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FNO2S3/c1-27(23,24)14-10-8-13(9-11-14)19-18(15-5-2-3-6-16(15)21)22-20(26-19)17-7-4-12-25-17/h2-12H,1H3.
What are the key properties of 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole?
4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole has a molecular weight of 415.54 g/mol, XLogP of 5.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-thiophen-2-yl-1,3-thiazole is sourced from PubChem (CID 67669491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).