C13H14O4 — CID 67670827
3,4-dimethoxytricyclo[5.3.1.01,6]undeca-3,8-diene-2,5-dione (PubChem CID 67670827) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3,4-dimethoxytricyclo[5.3.1.01,6]undeca-3,8-diene-2,5-dione.
| Compound Name | 3,4-dimethoxytricyclo[5.3.1.01,6]undeca-3,8-diene-2,5-dione |
|---|---|
| PubChem CID | 67670827 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3,4-dimethoxytricyclo[5.3.1.01,6]undeca-3,8-diene-2,5-dione |
| SMILES | COC1=C(OC)C(=O)C23CC=CC(C2)C3C1=O |
| InChI | InChI=1S/C13H14O4/c1-16-10-9(14)8-7-4-3-5-13(8,6-7)12(15)11(10)17-2/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | HWZPCWOQMRDEEV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|