About (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate
(1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate (PubChem CID 67671433) has the molecular formula C22H25NO5
and a molecular weight of 383.44 g/mol. Its IUPAC name is (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate.
Molecular Properties
| Compound Name | (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate |
| PubChem CID | 67671433 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate |
| SMILES | CC(C)(C)C(OC(=O)c1c(C#N)ccc2cocc12)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C22H25NO5/c1-22(2,3)19(21(25)27-16-7-5-4-6-8-16)28-20(24)18-14(11-23)9-10-15-12-26-13-17(15)18/h9-10,12-13,16,19H,4-8H2,1-3H3 |
| InChIKey | CQCBCDOYPCYLRH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate?
The IUPAC name of (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate (CID 67671433) is (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate.
What is the SMILES notation for (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate?
The canonical SMILES for (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate is CC(C)(C)C(OC(=O)c1c(C#N)ccc2cocc12)C(=O)OC1CCCCC1.
What is the InChIKey of (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate?
The InChIKey is CQCBCDOYPCYLRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO5/c1-22(2,3)19(21(25)27-16-7-5-4-6-8-16)28-20(24)18-14(11-23)9-10-15-12-26-13-17(15)18/h9-10,12-13,16,19H,4-8H2,1-3H3.
What are the key properties of (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate?
(1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate has a molecular weight of 383.44 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyloxy-3,3-dimethyl-1-oxobutan-2-yl) 5-cyano-2-benzofuran-4-carboxylate is sourced from PubChem (CID 67671433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).