C17H30O4 — CID 67671667
(6S,7S,10S)-10-methyl-7-non-8-en-3-yl-1,4,8-trioxaspiro[4.5]decan-6-ol (PubChem CID 67671667) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (6S,7S,10S)-10-methyl-7-non-8-en-3-yl-1,4,8-trioxaspiro[4.5]decan-6-ol.
| Compound Name | (6S,7S,10S)-10-methyl-7-non-8-en-3-yl-1,4,8-trioxaspiro[4.5]decan-6-ol |
|---|---|
| PubChem CID | 67671667 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (6S,7S,10S)-10-methyl-7-non-8-en-3-yl-1,4,8-trioxaspiro[4.5]decan-6-ol |
| SMILES | C=CCCCCC(CC)[C@@H]1OC[C@H](C)C2(OCCO2)[C@H]1O |
| InChI | InChI=1S/C17H30O4/c1-4-6-7-8-9-14(5-2)15-16(18)17(13(3)12-19-15)20-10-11-21-17/h4,13-16,18H,1,5-12H2,2-3H3/t13-,14?,15-,16-/m0/s1 |
| InChIKey | ZFVIFWBBMWUXCD-PBBYBOOSSA-N |
| XLogP | 2.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|