About 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane
3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane (PubChem CID 67671805) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane.
Molecular Properties
| Compound Name | 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane |
| PubChem CID | 67671805 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane |
| SMILES | C=C(CC1CCCOC1)C[C@H](OC)[C@@H](C)CCCC |
| InChI | InChI=1S/C17H32O2/c1-5-6-8-15(3)17(18-4)12-14(2)11-16-9-7-10-19-13-16/h15-17H,2,5-13H2,1,3-4H3/t15-,16?,17-/m0/s1 |
| InChIKey | NJZDZISSSDQJCH-QRFGZVGRSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane?
The IUPAC name of 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane (CID 67671805) is 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane.
What is the SMILES notation for 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane?
The canonical SMILES for 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane is C=C(CC1CCCOC1)C[C@H](OC)[C@@H](C)CCCC.
What is the InChIKey of 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane?
The InChIKey is NJZDZISSSDQJCH-QRFGZVGRSA-N. The full InChI is InChI=1S/C17H32O2/c1-5-6-8-15(3)17(18-4)12-14(2)11-16-9-7-10-19-13-16/h15-17H,2,5-13H2,1,3-4H3/t15-,16?,17-/m0/s1.
What are the key properties of 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane?
3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane has a molecular weight of 268.44 g/mol, XLogP of 4.59, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S,5S)-4-methoxy-5-methyl-2-methylidenenonyl]oxane is sourced from PubChem (CID 67671805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).