C19H23ClF3NO6 — CID 67672039
[(2S,3R,4S,5S)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid (PubChem CID 67672039) has the molecular formula C19H23ClF3NO6 and a molecular weight of 453.84 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,3R,4S,5S)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67672039 |
| Molecular Formula | C19H23ClF3NO6 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [(2S,3R,4S,5S)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1[C@@H](OC(=O)CN)[C@H](/C=C/c2ccc(Cl)cc2)OC[C@@H]1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22ClNO4.C2HF3O2/c1-11-10-22-14(8-5-12-3-6-13(18)7-4-12)17(16(11)21-2)23-15(20)9-19;3-2(4,5)1(6)7/h3-8,11,14,16-17H,9-10,19H2,1-2H3;(H,6,7)/b8-5+;/t11-,14-,16-,17-;/m0./s1 |
| InChIKey | WTNNCANIIPVIPV-YYYDMTRASA-N |
| XLogP | 2.91 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |