C22H44O3Si — CID 67672314
tert-butyl-[(3R,4S,5S)-4-methoxy-5-methyl-2-[(2S)-oxan-2-yl]non-1-en-3-yl]oxy-dimethylsilane (PubChem CID 67672314) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is tert-butyl-[(3R,4S,5S)-4-methoxy-5-methyl-2-[(2S)-oxan-2-yl]non-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S,5S)-4-methoxy-5-methyl-2-[(2S)-oxan-2-yl]non-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 67672314 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | tert-butyl-[(3R,4S,5S)-4-methoxy-5-methyl-2-[(2S)-oxan-2-yl]non-1-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C([C@@H]1CCCCO1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)[C@@H](C)CCCC |
| InChI | InChI=1S/C22H44O3Si/c1-10-11-14-17(2)20(23-7)21(25-26(8,9)22(4,5)6)18(3)19-15-12-13-16-24-19/h17,19-21H,3,10-16H2,1-2,4-9H3/t17-,19-,20-,21+/m0/s1 |
| InChIKey | VXDOPWDZGGUESY-ZIBCJSCZSA-N |
| XLogP | 6.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|