About 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol
1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol (PubChem CID 67672374) has the molecular formula C21H26O
and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol |
| PubChem CID | 67672374 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol |
| SMILES | C=CC(O)C1CC(C)(C)CCC1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H26O/c1-4-20(22)19-14-21(2,3)12-11-18(19)17-10-9-15-7-5-6-8-16(15)13-17/h4-10,13,18-20,22H,1,11-12,14H2,2-3H3 |
| InChIKey | JIJQZGPBDJABDU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol?
The IUPAC name of 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol (CID 67672374) is 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol.
What is the SMILES notation for 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol?
The canonical SMILES for 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol is C=CC(O)C1CC(C)(C)CCC1c1ccc2ccccc2c1.
What is the InChIKey of 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol?
The InChIKey is JIJQZGPBDJABDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O/c1-4-20(22)19-14-21(2,3)12-11-18(19)17-10-9-15-7-5-6-8-16(15)13-17/h4-10,13,18-20,22H,1,11-12,14H2,2-3H3.
What are the key properties of 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol?
1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol has a molecular weight of 294.44 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethyl-2-naphthalen-2-ylcyclohexyl)prop-2-en-1-ol is sourced from PubChem (CID 67672374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).