About N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide
N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide (PubChem CID 67672709) has the molecular formula C24H20Cl2N2O2
and a molecular weight of 439.34 g/mol. Its IUPAC name is N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide |
| PubChem CID | 67672709 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide |
| SMILES | CC1CN(C(=O)c2ccccc2)c2ccccc2C1NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-15-14-28(24(30)16-7-3-2-4-8-16)21-10-6-5-9-20(21)22(15)27-23(29)17-11-18(25)13-19(26)12-17/h2-13,15,22H,14H2,1H3,(H,27,29) |
| InChIKey | DIWWEZLHNSJXCT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide?
The IUPAC name of N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide (CID 67672709) is N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide.
What is the SMILES notation for N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide?
The canonical SMILES for N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide is CC1CN(C(=O)c2ccccc2)c2ccccc2C1NC(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide?
The InChIKey is DIWWEZLHNSJXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20Cl2N2O2/c1-15-14-28(24(30)16-7-3-2-4-8-16)21-10-6-5-9-20(21)22(15)27-23(29)17-11-18(25)13-19(26)12-17/h2-13,15,22H,14H2,1H3,(H,27,29).
What are the key properties of N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide?
N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide has a molecular weight of 439.34 g/mol, XLogP of 5.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzoyl-3-methyl-3,4-dihydro-2H-quinolin-4-yl)-3,5-dichlorobenzamide is sourced from PubChem (CID 67672709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).