C34H38Br2N4 — CID 67673633
2,18-bis(3-bromopropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin (PubChem CID 67673633) has the molecular formula C34H38Br2N4 and a molecular weight of 662.51 g/mol. Its IUPAC name is 2,18-bis(3-bromopropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin.
| Compound Name | 2,18-bis(3-bromopropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin |
|---|---|
| PubChem CID | 67673633 |
| Molecular Formula | C34H38Br2N4 |
| Molecular Weight | 662.51 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 2,18-bis(3-bromopropyl)-7,12-diethyl-3,8,13,17-tetramethylporphyrin |
| SMILES | CCC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(C)=C5CC)C(C)=C4CCCBr)C(CCCBr)=C3C |
| InChI | InChI=1S/C34H38Br2N4/c1-7-23-19(3)27-15-28-21(5)25(11-9-13-35)33(39-28)18-34-26(12-10-14-36)22(6)30(40-34)17-32-24(8-2)20(4)29(38-32)16-31(23)37-27/h15-18H,7-14H2,1-6H3/b27-15-,28-15-,29-16-,30-17-,31-16-,32-17-,33-18-,34-18- |
| InChIKey | QGATWKSONMSWAP-MFBGAUBSSA-N |
| XLogP | 9.79 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.51 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|