About 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol
4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol (PubChem CID 67673997) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol.
Molecular Properties
| Compound Name | 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol |
| PubChem CID | 67673997 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol |
| SMILES | C/C=C\C(O)(/C=C/C)c1cocc1O |
| InChI | InChI=1S/C11H14O3/c1-3-5-11(13,6-4-2)9-7-14-8-10(9)12/h3-8,12-13H,1-2H3/b5-3-,6-4+ |
| InChIKey | FEXXARJMGBKXFF-CIIODKQPSA-N |
| XLogP | 2.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol?
The IUPAC name of 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol (CID 67673997) is 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol.
What is the SMILES notation for 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol?
The canonical SMILES for 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol is C/C=C\C(O)(/C=C/C)c1cocc1O.
What is the InChIKey of 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol?
The InChIKey is FEXXARJMGBKXFF-CIIODKQPSA-N. The full InChI is InChI=1S/C11H14O3/c1-3-5-11(13,6-4-2)9-7-14-8-10(9)12/h3-8,12-13H,1-2H3/b5-3-,6-4+.
What are the key properties of 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol?
4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol has a molecular weight of 194.23 g/mol, XLogP of 2.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2Z,5E)-4-hydroxyhepta-2,5-dien-4-yl]furan-3-ol is sourced from PubChem (CID 67673997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).