C20H34N2O2 — CID 67674009
N-(3-ethyl-3-methylpentyl)-6-hexoxypyridine-3-carboxamide (PubChem CID 67674009) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is N-(3-ethyl-3-methylpentyl)-6-hexoxypyridine-3-carboxamide.
| Compound Name | N-(3-ethyl-3-methylpentyl)-6-hexoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 67674009 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | N-(3-ethyl-3-methylpentyl)-6-hexoxypyridine-3-carboxamide |
| SMILES | CCCCCCOc1ccc(C(=O)NCCC(C)(CC)CC)cn1 |
| InChI | InChI=1S/C20H34N2O2/c1-5-8-9-10-15-24-18-12-11-17(16-22-18)19(23)21-14-13-20(4,6-2)7-3/h11-12,16H,5-10,13-15H2,1-4H3,(H,21,23) |
| InChIKey | BPIBTAWNNHJRGM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|