C22H32N2 — CID 67674053
3-cyclododeca-1,3,5-trien-1-yl-1,2-diazacyclododeca-2,10,12-triene (PubChem CID 67674053) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-cyclododeca-1,3,5-trien-1-yl-1,2-diazacyclododeca-2,10,12-triene.
| Compound Name | 3-cyclododeca-1,3,5-trien-1-yl-1,2-diazacyclododeca-2,10,12-triene |
|---|---|
| PubChem CID | 67674053 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 3-cyclododeca-1,3,5-trien-1-yl-1,2-diazacyclododeca-2,10,12-triene |
| SMILES | C1=CC=C(C2=NN=CC=CCCCCCC2)CCCCCCC=C1 |
| InChI | InChI=1S/C22H32N2/c1-2-5-9-13-17-21(18-14-10-6-3-1)22-19-15-11-7-4-8-12-16-20-23-24-22/h2,5,9,12-13,16-17,20H,1,3-4,6-8,10-11,14-15,18-19H2 |
| InChIKey | FFVAQEDNIPYZPM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |