C18H26O3 — CID 67674176
(2S,3R,4S,5S)-2-ethenyl-4-methoxy-5-methyl-2-(4-propylphenyl)oxan-3-ol (PubChem CID 67674176) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-ethenyl-4-methoxy-5-methyl-2-(4-propylphenyl)oxan-3-ol.
| Compound Name | (2S,3R,4S,5S)-2-ethenyl-4-methoxy-5-methyl-2-(4-propylphenyl)oxan-3-ol |
|---|---|
| PubChem CID | 67674176 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2S,3R,4S,5S)-2-ethenyl-4-methoxy-5-methyl-2-(4-propylphenyl)oxan-3-ol |
| SMILES | C=C[C@@]1(c2ccc(CCC)cc2)OC[C@H](C)[C@H](OC)[C@H]1O |
| InChI | InChI=1S/C18H26O3/c1-5-7-14-8-10-15(11-9-14)18(6-2)17(19)16(20-4)13(3)12-21-18/h6,8-11,13,16-17,19H,2,5,7,12H2,1,3-4H3/t13-,16-,17+,18-/m0/s1 |
| InChIKey | KKBGQKYCBYKPBS-RUGDWHBFSA-N |
| XLogP | 3.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|