C32H45NO5S — CID 67674639
1-[3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]butan-1-one;decanedioic acid (PubChem CID 67674639) has the molecular formula C32H45NO5S and a molecular weight of 555.78 g/mol. Its IUPAC name is 1-[3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]butan-1-one;decanedioic acid.
| Compound Name | 1-[3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]butan-1-one;decanedioic acid |
|---|---|
| PubChem CID | 67674639 |
| Molecular Formula | C32H45NO5S |
| Molecular Weight | 555.78 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | 1-[3-(1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]butan-1-one;decanedioic acid |
| SMILES | CCCC(=O)c1ccc2scc(C3=CCN4CCCCC4CC3)c2c1.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H27NOS.C10H18O4/c1-2-5-21(24)17-8-10-22-19(14-17)20(15-25-22)16-7-9-18-6-3-4-12-23(18)13-11-16;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h8,10-11,14-15,18H,2-7,9,12-13H2,1H3;1-8H2,(H,11,12)(H,13,14) |
| InChIKey | YIFNCDWZUIQPMI-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.78 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|