About cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid
cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 67674765) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 67674765 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid |
| SMILES | N[C@H](C(=O)O)C(C1c2ccccc2Oc2ccccc21)[C@@H]1C[C@@H]1C(=O)O |
| InChI | InChI=1S/C20H19NO5/c21-18(20(24)25)17(12-9-13(12)19(22)23)16-10-5-1-3-7-14(10)26-15-8-4-2-6-11(15)16/h1-8,12-13,16-18H,9,21H2,(H,22,23)(H,24,25)/t12-,13+,17?,18+/m1/s1 |
| InChIKey | DEQUHXDUGTWTTP-DWYMVEFQSA-N |
| XLogP | 2.67 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid (CID 67674765) is cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid is N[C@H](C(=O)O)C(C1c2ccccc2Oc2ccccc21)[C@@H]1C[C@@H]1C(=O)O.
What is the InChIKey of cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid?
The InChIKey is DEQUHXDUGTWTTP-DWYMVEFQSA-N. The full InChI is InChI=1S/C20H19NO5/c21-18(20(24)25)17(12-9-13(12)19(22)23)16-10-5-1-3-7-14(10)26-15-8-4-2-6-11(15)16/h1-8,12-13,16-18H,9,21H2,(H,22,23)(H,24,25)/t12-,13+,17?,18+/m1/s1.
What are the key properties of cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid?
cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid has a molecular weight of 353.37 g/mol, XLogP of 2.67, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-[(2S)-2-amino-2-carboxy-1-(9H-xanthen-9-yl)ethyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 67674765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).